C27H29N3O8S2 — CID 118401188
(E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide (PubChem CID 118401188) has the molecular formula C27H29N3O8S2 and a molecular weight of 587.68 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 118401188 |
| Molecular Formula | C27H29N3O8S2 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide |
| SMILES | N#C/C(=C\c1ccc(-c2ccc3cc(N4CCOCC4)ccc3c2)s1)S(=O)(=O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H29N3O8S2/c28-14-21(40(35,36)29-15-22-24(31)25(32)26(33)27(34)38-22)13-20-5-6-23(39-20)18-2-1-17-12-19(4-3-16(17)11-18)30-7-9-37-10-8-30/h1-6,11-13,22,24-27,29,31-34H,7-10,15H2/b21-13+/t22-,24-,25+,26-,27?/m1/s1 |
| InChIKey | DBMWFXXNYTXMNW-YLYMWPCWSA-N |
| XLogP | 0.99 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|