C31H37N3O6S — CID 118401193
(E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide (PubChem CID 118401193) has the molecular formula C31H37N3O6S and a molecular weight of 579.72 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 118401193 |
| Molecular Formula | C31H37N3O6S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | (E)-2-cyano-3-[5-[6-(dipropylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide |
| SMILES | CCCN(CCC)c1ccc2cc(-c3ccc(/C(C)=C(\C#N)C(=O)NC[C@H]4OC(O)[C@H](O)[C@@H](O)[C@@H]4O)s3)ccc2c1 |
| InChI | InChI=1S/C31H37N3O6S/c1-4-12-34(13-5-2)22-9-8-19-14-21(7-6-20(19)15-22)26-11-10-25(41-26)18(3)23(16-32)30(38)33-17-24-27(35)28(36)29(37)31(39)40-24/h6-11,14-15,24,27-29,31,35-37,39H,4-5,12-13,17H2,1-3H3,(H,33,38)/b23-18+/t24-,27-,28+,29-,31?/m1/s1 |
| InChIKey | VXHMNGYGKHXTHK-MVZYMSTNSA-N |
| XLogP | 3.41 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|