C29H34N4O7S2 — CID 118401194
(E)-1-cyano-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide (PubChem CID 118401194) has the molecular formula C29H34N4O7S2 and a molecular weight of 614.75 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 118401194 |
| Molecular Formula | C29H34N4O7S2 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(/C#N)S(=O)(=O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(N4CCN(C)CC4)ccc3c2)s1 |
| InChI | InChI=1S/C29H34N4O7S2/c1-17(25(15-30)42(38,39)31-16-22-26(34)27(35)28(36)29(37)40-22)23-7-8-24(41-23)20-4-3-19-14-21(6-5-18(19)13-20)33-11-9-32(2)10-12-33/h3-8,13-14,22,26-29,31,34-37H,9-12,16H2,1-2H3/b25-17+/t22-,26-,27+,28-,29?/m1/s1 |
| InChIKey | PNPJOLXYVPNOJW-MINWDNKDSA-N |
| XLogP | 1.29 |
| TPSA | 166.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|