C25H27N3O7S2 — CID 118401195
(E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide (PubChem CID 118401195) has the molecular formula C25H27N3O7S2 and a molecular weight of 545.64 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 118401195 |
| Molecular Formula | C25H27N3O7S2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(dimethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]ethenesulfonamide |
| SMILES | CN(C)c1ccc2cc(-c3ccc(/C=C(\C#N)S(=O)(=O)NC[C@H]4OC(O)[C@H](O)[C@@H](O)[C@@H]4O)s3)ccc2c1 |
| InChI | InChI=1S/C25H27N3O7S2/c1-28(2)17-6-5-14-9-16(4-3-15(14)10-17)21-8-7-18(36-21)11-19(12-26)37(33,34)27-13-20-22(29)23(30)24(31)25(32)35-20/h3-11,20,22-25,27,29-32H,13H2,1-2H3/b19-11+/t20-,22-,23+,24-,25?/m1/s1 |
| InChIKey | ZZAYRWHWPQYORF-QGFYKWATSA-N |
| XLogP | 1.22 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|