About (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole
(2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole (PubChem CID 118401251) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole.
Molecular Properties
| Compound Name | (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole |
| PubChem CID | 118401251 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole |
| SMILES | C=C1C=C(CCC)N[C@H]1CCSC |
| InChI | InChI=1S/C11H19NS/c1-4-5-10-8-9(2)11(12-10)6-7-13-3/h8,11-12H,2,4-7H2,1,3H3/t11-/m0/s1 |
| InChIKey | GZASDZRHWXXBCZ-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole?
The IUPAC name of (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole (CID 118401251) is (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole.
What is the SMILES notation for (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole?
The canonical SMILES for (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole is C=C1C=C(CCC)N[C@H]1CCSC.
What is the InChIKey of (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole?
The InChIKey is GZASDZRHWXXBCZ-NSHDSACASA-N. The full InChI is InChI=1S/C11H19NS/c1-4-5-10-8-9(2)11(12-10)6-7-13-3/h8,11-12H,2,4-7H2,1,3H3/t11-/m0/s1.
What are the key properties of (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole?
(2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole has a molecular weight of 197.35 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methylidene-2-(2-methylsulfanylethyl)-5-propyl-1,2-dihydropyrrole is sourced from PubChem (CID 118401251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).