C20H23FN4 — CID 118401258
8-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-4,12-dimethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene (PubChem CID 118401258) has the molecular formula C20H23FN4 and a molecular weight of 338.43 g/mol. Its IUPAC name is 8-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-4,12-dimethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene.
| Compound Name | 8-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-4,12-dimethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 118401258 |
| Molecular Formula | C20H23FN4 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 8-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-4,12-dimethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
| SMILES | Cc1ccc2c(n1)c1c(n2CCc2ccc(CF)nc2)CCN(C)C1 |
| InChI | InChI=1S/C20H23FN4/c1-14-3-6-19-20(23-14)17-13-24(2)9-8-18(17)25(19)10-7-15-4-5-16(11-21)22-12-15/h3-6,12H,7-11,13H2,1-2H3 |
| InChIKey | GVOZINPOEFOQDO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |