C21H22ClFN4 — CID 118401270
14-chloro-10-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene (PubChem CID 118401270) has the molecular formula C21H22ClFN4 and a molecular weight of 384.89 g/mol. Its IUPAC name is 14-chloro-10-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene.
| Compound Name | 14-chloro-10-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 118401270 |
| Molecular Formula | C21H22ClFN4 |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 14-chloro-10-[2-[6-(fluoromethyl)-3-pyridinyl]ethyl]-6,10,12-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraene |
| SMILES | FCc1ccc(CCn2c3c(c4cc(Cl)cnc42)C2CCCN2CC3)cn1 |
| InChI | InChI=1S/C21H22ClFN4/c22-15-10-17-20-18-2-1-7-26(18)8-6-19(20)27(21(17)25-13-15)9-5-14-3-4-16(11-23)24-12-14/h3-4,10,12-13,18H,1-2,5-9,11H2 |
| InChIKey | OBHZAUDFTHLVHS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |