C21H25N7O3S — CID 118401320
N-[[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]methanesulfonamide (PubChem CID 118401320) has the molecular formula C21H25N7O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 118401320 |
| Molecular Formula | C21H25N7O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]methyl]methanesulfonamide |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(CNS(C)(=O)=O)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C21H25N7O3S/c1-3-17(29)27-10-4-5-16(12-27)28-21-18(20(22)23-13-24-21)19(26-28)15-8-6-14(7-9-15)11-25-32(2,30)31/h3,6-9,13,16,25H,1,4-5,10-12H2,2H3,(H2,22,23,24) |
| InChIKey | OKHJSOLRZUJGGU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|