C49H85F2N3O11 — CID 118401537
butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate (PubChem CID 118401537) has the molecular formula C49H85F2N3O11 and a molecular weight of 930.22 g/mol. Its IUPAC name is butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 118401537 |
| Molecular Formula | C49H85F2N3O11 |
| Molecular Weight | 930.22 g/mol |
| Exact Mass | 929.62 |
| IUPAC Name | butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate |
| SMILES | CCCCOC[C@H]1O[C@@](OCCCC)(C(F)(F)CNCCCC[C@H](NC(=O)OCc2ccccc2)C(=O)N[C@@H](C)C(=O)OCCCC)[C@H](OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C49H85F2N3O11/c1-8-14-29-58-36-41-42(59-30-15-9-2)43(60-31-16-10-3)44(61-32-17-11-4)49(65-41,64-34-19-13-6)48(50,51)37-52-28-24-23-27-40(45(55)53-38(7)46(56)62-33-18-12-5)54-47(57)63-35-39-25-21-20-22-26-39/h20-22,25-26,38,40-44,52H,8-19,23-24,27-37H2,1-7H3,(H,53,55)(H,54,57)/t38-,40-,41+,42-,43-,44+,49+/m0/s1 |
| InChIKey | FPHIDVAAXQAQJC-ZNYQVGKFSA-N |
| XLogP | 8.81 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.22 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|