C46H80F2N2O10 — CID 118401547
butyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 118401547) has the molecular formula C46H80F2N2O10 and a molecular weight of 859.15 g/mol. Its IUPAC name is butyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | butyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 118401547 |
| Molecular Formula | C46H80F2N2O10 |
| Molecular Weight | 859.15 g/mol |
| Exact Mass | 858.58 |
| IUPAC Name | butyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCCCOC[C@H]1O[C@@](OCCCC)(C(F)(F)CNCCCC[C@H](NC(=O)OCc2ccccc2)C(=O)OCCCC)[C@H](OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C46H80F2N2O10/c1-7-13-28-53-35-39-40(54-29-14-8-2)41(55-30-15-9-3)42(56-31-16-10-4)46(60-39,59-33-18-12-6)45(47,48)36-49-27-23-22-26-38(43(51)57-32-17-11-5)50-44(52)58-34-37-24-20-19-21-25-37/h19-21,24-25,38-42,49H,7-18,22-23,26-36H2,1-6H3,(H,50,52)/t38-,39+,40-,41-,42+,46+/m0/s1 |
| InChIKey | KODHBYTXKHDWBC-KOXRBGFGSA-N |
| XLogP | 9.30 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.15 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|