C8H12F2O8 — CID 118401577
2,2-difluoro-2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]acetic acid (PubChem CID 118401577) has the molecular formula C8H12F2O8 and a molecular weight of 274.17 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]acetic acid.
| Compound Name | 2,2-difluoro-2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 118401577 |
| Molecular Formula | C8H12F2O8 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2,2-difluoro-2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]acetic acid |
| SMILES | O=C(O)C(F)(F)[C@]1(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H12F2O8/c9-7(10,6(15)16)8(17)5(14)4(13)3(12)2(1-11)18-8/h2-5,11-14,17H,1H2,(H,15,16)/t2-,3+,4+,5-,8-/m1/s1 |
| InChIKey | GHTWVLCGILIPOL-FBAAROJDSA-N |
| XLogP | -3.13 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |