C15H29N4O8P — CID 118402564
[(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-ethyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydropyran-6-yl]-ethoxyphosphinic acid (PubChem CID 118402564) has the molecular formula C15H29N4O8P and a molecular weight of 424.39 g/mol. Its IUPAC name is [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-ethyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydropyran-6-yl]-ethoxyphosphinic acid.
| Compound Name | [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-ethyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydropyran-6-yl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 118402564 |
| Molecular Formula | C15H29N4O8P |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-ethyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydropyran-6-yl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C1=C[C@H](N=C(N)N)[C@@H](NC(C)=O)[C@](CC)([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C15H29N4O8P/c1-4-15(13(23)10(22)7-20)12(18-8(3)21)9(19-14(16)17)6-11(27-15)28(24,25)26-5-2/h6,9-10,12-13,20,22-23H,4-5,7H2,1-3H3,(H,18,21)(H,24,25)(H4,16,17,19)/t9-,10+,12+,13+,15+/m0/s1 |
| InChIKey | MSMZKPKZPCGNJB-KHBBOIOASA-N |
| XLogP | -1.91 |
| TPSA | 209.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|