About 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine
2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine (PubChem CID 118403159) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine.
Molecular Properties
| Compound Name | 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine |
| PubChem CID | 118403159 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine |
| SMILES | C=C/C=C\C(=C/C)CN=C(N)N |
| InChI | InChI=1S/C9H15N3/c1-3-5-6-8(4-2)7-12-9(10)11/h3-6H,1,7H2,2H3,(H4,10,11,12)/b6-5-,8-4+ |
| InChIKey | HCSKGCJBQBAJLK-QNMAEOQASA-N |
| XLogP | 0.95 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine?
The IUPAC name of 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine (CID 118403159) is 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine.
What is the SMILES notation for 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine?
The canonical SMILES for 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine is C=C/C=C\C(=C/C)CN=C(N)N.
What is the InChIKey of 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine?
The InChIKey is HCSKGCJBQBAJLK-QNMAEOQASA-N. The full InChI is InChI=1S/C9H15N3/c1-3-5-6-8(4-2)7-12-9(10)11/h3-6H,1,7H2,2H3,(H4,10,11,12)/b6-5-,8-4+.
What are the key properties of 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine?
2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine has a molecular weight of 165.24 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]guanidine is sourced from PubChem (CID 118403159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).