C14H19NO7 — CID 118403206
[6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate (PubChem CID 118403206) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is [6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate.
| Compound Name | [6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate |
|---|---|
| PubChem CID | 118403206 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [6-(3-cyanatopropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] butanoate |
| SMILES | CCCC(=O)OC1COC2C(OC(=O)CCOC#N)COC12 |
| InChI | InChI=1S/C14H19NO7/c1-2-3-11(16)21-9-6-19-14-10(7-20-13(9)14)22-12(17)4-5-18-8-15/h9-10,13-14H,2-7H2,1H3 |
| InChIKey | QYERMIUJRVDDHF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|