C12H15NO7 — CID 118403211
[(3S,3aR,6S,6aR)-6-(2-cyanatoacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] propanoate (PubChem CID 118403211) has the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-(2-cyanatoacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] propanoate.
| Compound Name | [(3S,3aR,6S,6aR)-6-(2-cyanatoacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] propanoate |
|---|---|
| PubChem CID | 118403211 |
| Molecular Formula | C12H15NO7 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-(2-cyanatoacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)COC#N |
| InChI | InChI=1S/C12H15NO7/c1-2-9(14)19-7-3-17-12-8(4-18-11(7)12)20-10(15)5-16-6-13/h7-8,11-12H,2-5H2,1H3/t7-,8-,11+,12+/m0/s1 |
| InChIKey | PXEUXHZLPYXNIT-LDDIKCJXSA-N |
| XLogP | -0.48 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|