C23H26F2N4O2 — CID 118403400
N-[(E)-2-aminohex-4-enyl]-8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 118403400) has the molecular formula C23H26F2N4O2 and a molecular weight of 428.48 g/mol. Its IUPAC name is N-[(E)-2-aminohex-4-enyl]-8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[(E)-2-aminohex-4-enyl]-8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118403400 |
| Molecular Formula | C23H26F2N4O2 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[(E)-2-aminohex-4-enyl]-8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | C/C=C/CC(N)CNC(=O)c1c(C)nc2c(OCc3c(F)cccc3F)cc(C)cn12 |
| InChI | InChI=1S/C23H26F2N4O2/c1-4-5-7-16(26)11-27-23(30)21-15(3)28-22-20(10-14(2)12-29(21)22)31-13-17-18(24)8-6-9-19(17)25/h4-6,8-10,12,16H,7,11,13,26H2,1-3H3,(H,27,30)/b5-4+ |
| InChIKey | PNTQVXQNLLEYGR-SNAWJCMRSA-N |
| XLogP | 3.83 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|