C27H18N4 — CID 118403810
9-phenyl-6-(5-pyridin-2-yl-2-pyridinyl)pyrido[2,3-b]indole (PubChem CID 118403810) has the molecular formula C27H18N4 and a molecular weight of 398.47 g/mol. Its IUPAC name is 9-phenyl-6-(5-pyridin-2-yl-2-pyridinyl)pyrido[2,3-b]indole.
| Compound Name | 9-phenyl-6-(5-pyridin-2-yl-2-pyridinyl)pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 118403810 |
| Molecular Formula | C27H18N4 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 9-phenyl-6-(5-pyridin-2-yl-2-pyridinyl)pyrido[2,3-b]indole |
| SMILES | c1ccc(-n2c3ccc(-c4ccc(-c5ccccn5)cn4)cc3c3cccnc32)cc1 |
| InChI | InChI=1S/C27H18N4/c1-2-7-21(8-3-1)31-26-14-12-19(17-23(26)22-9-6-16-29-27(22)31)25-13-11-20(18-30-25)24-10-4-5-15-28-24/h1-18H |
| InChIKey | NTVXXAXBXRKXLF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |