C16H18N6OS — CID 118404199
(2R,3S,4S,5R)-5-ethyl-3,4-dimethyl-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolane-2,3-dicarbonitrile (PubChem CID 118404199) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-ethyl-3,4-dimethyl-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolane-2,3-dicarbonitrile.
| Compound Name | (2R,3S,4S,5R)-5-ethyl-3,4-dimethyl-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolane-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 118404199 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (2R,3S,4S,5R)-5-ethyl-3,4-dimethyl-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolane-2,3-dicarbonitrile |
| SMILES | CC[C@H]1O[C@@](C#N)(c2cnc3c(SC)ncnn23)[C@](C)(C#N)[C@@H]1C |
| InChI | InChI=1S/C16H18N6OS/c1-5-11-10(2)15(3,7-17)16(8-18,23-11)12-6-19-13-14(24-4)20-9-21-22(12)13/h6,9-11H,5H2,1-4H3/t10-,11-,15-,16+/m1/s1 |
| InChIKey | GZPKKCUCVBZUOB-WVATUKLVSA-N |
| XLogP | 2.54 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |