C22H21F3O8S2 — CID 118404253
[(6S,8S,8aS)-2-phenyl-6-phenylsulfanyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 118404253) has the molecular formula C22H21F3O8S2 and a molecular weight of 534.53 g/mol. Its IUPAC name is [(6S,8S,8aS)-2-phenyl-6-phenylsulfanyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(6S,8S,8aS)-2-phenyl-6-phenylsulfanyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 118404253 |
| Molecular Formula | C22H21F3O8S2 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | [(6S,8S,8aS)-2-phenyl-6-phenylsulfanyl-8-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]2OC(c3ccccc3)OCC2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C22H21F3O8S2/c1-13(26)30-19-18(33-35(27,28)22(23,24)25)17-16(31-21(19)34-15-10-6-3-7-11-15)12-29-20(32-17)14-8-4-2-5-9-14/h2-11,16-21H,12H2,1H3/t16?,17-,18-,19?,20?,21-/m0/s1 |
| InChIKey | BKETZAZSDQACDF-VPEZYPFVSA-N |
| XLogP | 3.78 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|