C17H24O9 — CID 118404310
5-[[(3S,3aR,6S,6aR)-3-(5-oxohexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-oxopentanoic acid (PubChem CID 118404310) has the molecular formula C17H24O9 and a molecular weight of 372.37 g/mol. Its IUPAC name is 5-[[(3S,3aR,6S,6aR)-3-(5-oxohexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-oxopentanoic acid.
| Compound Name | 5-[[(3S,3aR,6S,6aR)-3-(5-oxohexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 118404310 |
| Molecular Formula | C17H24O9 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-[[(3S,3aR,6S,6aR)-3-(5-oxohexanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-oxopentanoic acid |
| SMILES | CC(=O)CCCC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC(=O)CCCC(=O)O |
| InChI | InChI=1S/C17H24O9/c1-10(18)4-2-6-14(21)25-11-8-23-17-12(9-24-16(11)17)26-15(22)7-3-5-13(19)20/h11-12,16-17H,2-9H2,1H3,(H,19,20)/t11-,12-,16+,17+/m0/s1 |
| InChIKey | HYTHNJNYLLLLMS-IYVPYFHTSA-N |
| XLogP | 0.62 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |