C38H56N2O8 — CID 118404367
4-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(3,5-dinitrophenyl)methyl] butanedioate (PubChem CID 118404367) has the molecular formula C38H56N2O8 and a molecular weight of 668.87 g/mol. Its IUPAC name is 4-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(3,5-dinitrophenyl)methyl] butanedioate.
| Compound Name | 4-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(3,5-dinitrophenyl)methyl] butanedioate |
|---|---|
| PubChem CID | 118404367 |
| Molecular Formula | C38H56N2O8 |
| Molecular Weight | 668.87 g/mol |
| Exact Mass | 668.40 |
| IUPAC Name | 4-O-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(3,5-dinitrophenyl)methyl] butanedioate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4CC(OC(=O)CCC(=O)OCc5cc([N+](=O)[O-])cc([N+](=O)[O-])c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C38H56N2O8/c1-24(2)7-6-8-25(3)32-11-12-33-31-10-9-27-21-30(15-17-37(27,4)34(31)16-18-38(32,33)5)48-36(42)14-13-35(41)47-23-26-19-28(39(43)44)22-29(20-26)40(45)46/h19-20,22,24-25,27,30-34H,6-18,21,23H2,1-5H3 |
| InChIKey | CZHAPWXSGXMXHK-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.87 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|