About diphenylboranyl 2-aminoacetate
diphenylboranyl 2-aminoacetate (PubChem CID 11840443) has the molecular formula C14H14BNO2
and a molecular weight of 239.08 g/mol. Its IUPAC name is diphenylboranyl 2-aminoacetate.
Molecular Properties
| Compound Name | diphenylboranyl 2-aminoacetate |
| PubChem CID | 11840443 |
| Molecular Formula | C14H14BNO2 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | diphenylboranyl 2-aminoacetate |
| SMILES | NCC(=O)OB(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14BNO2/c16-11-14(17)18-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11,16H2 |
| InChIKey | IVHLNYVPKWICDY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diphenylboranyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylboranyl 2-aminoacetate?
The IUPAC name of diphenylboranyl 2-aminoacetate (CID 11840443) is diphenylboranyl 2-aminoacetate.
What is the SMILES notation for diphenylboranyl 2-aminoacetate?
The canonical SMILES for diphenylboranyl 2-aminoacetate is NCC(=O)OB(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylboranyl 2-aminoacetate?
The InChIKey is IVHLNYVPKWICDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BNO2/c16-11-14(17)18-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11,16H2.
What are the key properties of diphenylboranyl 2-aminoacetate?
diphenylboranyl 2-aminoacetate has a molecular weight of 239.08 g/mol, XLogP of 0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylboranyl 2-aminoacetate is sourced from PubChem (CID 11840443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).