C7H12N2O2 — CID 118404444
5-methyl-1,3a,4,6,7,7a-hexahydro-[1,3]oxazolo[5,4-c]pyridin-2-one (PubChem CID 118404444) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 5-methyl-1,3a,4,6,7,7a-hexahydro-[1,3]oxazolo[5,4-c]pyridin-2-one.
| Compound Name | 5-methyl-1,3a,4,6,7,7a-hexahydro-[1,3]oxazolo[5,4-c]pyridin-2-one |
|---|---|
| PubChem CID | 118404444 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 5-methyl-1,3a,4,6,7,7a-hexahydro-[1,3]oxazolo[5,4-c]pyridin-2-one |
| SMILES | CN1CCC2NC(=O)OC2C1 |
| InChI | InChI=1S/C7H12N2O2/c1-9-3-2-5-6(4-9)11-7(10)8-5/h5-6H,2-4H2,1H3,(H,8,10) |
| InChIKey | FIKFQDFXQBQNTN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |