About 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine
2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine (PubChem CID 118404855) has the molecular formula C19H26N4+2
and a molecular weight of 310.45 g/mol. Its IUPAC name is 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine.
Molecular Properties
| Compound Name | 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine |
| PubChem CID | 118404855 |
| Molecular Formula | C19H26N4+2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine |
| SMILES | CC[n+]1ccc(/N=C(\C)C/C(C)=N/c2cc[n+](CC)cc2)cc1 |
| InChI | InChI=1S/C19H26N4/c1-5-22-11-7-18(8-12-22)20-16(3)15-17(4)21-19-9-13-23(6-2)14-10-19/h7-14H,5-6,15H2,1-4H3/q+2 |
| InChIKey | SEJHWNMSCCHITG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine?
The IUPAC name of 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine (CID 118404855) is 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine.
What is the SMILES notation for 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine?
The canonical SMILES for 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine is CC[n+]1ccc(/N=C(\C)C/C(C)=N/c2cc[n+](CC)cc2)cc1.
What is the InChIKey of 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine?
The InChIKey is SEJHWNMSCCHITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4/c1-5-22-11-7-18(8-12-22)20-16(3)15-17(4)21-19-9-13-23(6-2)14-10-19/h7-14H,5-6,15H2,1-4H3/q+2.
What are the key properties of 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine?
2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine has a molecular weight of 310.45 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-bis(1-ethylpyridin-1-ium-4-yl)pentane-2,4-diimine is sourced from PubChem (CID 118404855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).