About N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide
N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide (PubChem CID 1184065) has the molecular formula C15H16BrNO4S
and a molecular weight of 386.27 g/mol. Its IUPAC name is N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide |
| PubChem CID | 1184065 |
| Molecular Formula | C15H16BrNO4S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C15H16BrNO4S/c1-20-13-8-12(16)15(9-14(13)21-2)22(18,19)17-10-11-6-4-3-5-7-11/h3-9,17H,10H2,1-2H3 |
| InChIKey | GKUHHFPGUOKJCE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide?
The IUPAC name of N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide (CID 1184065) is N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide.
What is the SMILES notation for N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide?
The canonical SMILES for N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide is COc1cc(Br)c(S(=O)(=O)NCc2ccccc2)cc1OC.
What is the InChIKey of N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide?
The InChIKey is GKUHHFPGUOKJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrNO4S/c1-20-13-8-12(16)15(9-14(13)21-2)22(18,19)17-10-11-6-4-3-5-7-11/h3-9,17H,10H2,1-2H3.
What are the key properties of N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide?
N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide has a molecular weight of 386.27 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-bromo-4,5-dimethoxybenzenesulfonamide is sourced from PubChem (CID 1184065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).