C26H37NO6 — CID 118406672
1-[(1S,2S,3S,4S,5R,6R,9R,12S)-5,12-dihydroxy-2-(4-hydroxypiperidine-1-carbonyl)-6-methoxy-4-methyl-13-methylidene-4-tetracyclo[10.2.1.01,9.03,8]pentadec-7-enyl]ethanone (PubChem CID 118406672) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4S,5R,6R,9R,12S)-5,12-dihydroxy-2-(4-hydroxypiperidine-1-carbonyl)-6-methoxy-4-methyl-13-methylidene-4-tetracyclo[10.2.1.01,9.03,8]pentadec-7-enyl]ethanone.
| Compound Name | 1-[(1S,2S,3S,4S,5R,6R,9R,12S)-5,12-dihydroxy-2-(4-hydroxypiperidine-1-carbonyl)-6-methoxy-4-methyl-13-methylidene-4-tetracyclo[10.2.1.01,9.03,8]pentadec-7-enyl]ethanone |
|---|---|
| PubChem CID | 118406672 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 1-[(1S,2S,3S,4S,5R,6R,9R,12S)-5,12-dihydroxy-2-(4-hydroxypiperidine-1-carbonyl)-6-methoxy-4-methyl-13-methylidene-4-tetracyclo[10.2.1.01,9.03,8]pentadec-7-enyl]ethanone |
| SMILES | C=C1C[C@]23C[C@@]1(O)CC[C@H]2C1=C[C@@H](OC)[C@H](O)[C@@](C)(C(C)=O)[C@H]1[C@@H]3C(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C26H37NO6/c1-14-12-25-13-26(14,32)8-5-18(25)17-11-19(33-4)22(30)24(3,15(2)28)20(17)21(25)23(31)27-9-6-16(29)7-10-27/h11,16,18-22,29-30,32H,1,5-10,12-13H2,2-4H3/t18-,19+,20+,21+,22-,24-,25-,26-/m0/s1 |
| InChIKey | YMWQOWCLIMVHHO-KEBICLPGSA-N |
| XLogP | 1.60 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|