C33H30ClF3N4O4S — CID 118406874
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(5-sulfamoyl-2-pyridinyl)-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole-2-carboxamide (PubChem CID 118406874) has the molecular formula C33H30ClF3N4O4S and a molecular weight of 671.14 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(5-sulfamoyl-2-pyridinyl)-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(5-sulfamoyl-2-pyridinyl)-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118406874 |
| Molecular Formula | C33H30ClF3N4O4S |
| Molecular Weight | 671.14 g/mol |
| Exact Mass | 670.16 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(5-sulfamoyl-2-pyridinyl)-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)N(Cc3ccc(C(F)(F)F)cc3)c3ccc(S(N)(=O)=O)cn3)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C33H30ClF3N4O4S/c1-20-16-24(17-21(2)30(20)34)45-15-5-7-27-26-6-3-4-8-28(26)40-31(27)32(42)41(29-14-13-25(18-39-29)46(38,43)44)19-22-9-11-23(12-10-22)33(35,36)37/h3-4,6,8-14,16-18,40H,5,7,15,19H2,1-2H3,(H2,38,43,44) |
| InChIKey | ZHQRUHLRFVMUKA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.14 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|