C22H25ClN2O2 — CID 118406919
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N,N-dimethyl-1H-indole-2-carboxamide (PubChem CID 118406919) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N,N-dimethyl-1H-indole-2-carboxamide.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N,N-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118406919 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N,N-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(OCCCc2c(C(=O)N(C)C)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C22H25ClN2O2/c1-14-12-16(13-15(2)20(14)23)27-11-7-9-18-17-8-5-6-10-19(17)24-21(18)22(26)25(3)4/h5-6,8,10,12-13,24H,7,9,11H2,1-4H3 |
| InChIKey | FDSDCGIERHRZKS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|