About 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine
4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine (PubChem CID 118406999) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine |
| PubChem CID | 118406999 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine |
| SMILES | CC1CN(C2=CCCC=C2)CC(C)O1 |
| InChI | InChI=1S/C12H19NO/c1-10-8-13(9-11(2)14-10)12-6-4-3-5-7-12/h4,6-7,10-11H,3,5,8-9H2,1-2H3 |
| InChIKey | BWVCNPDMWYJTFT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine (CID 118406999) is 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine is CC1CN(C2=CCCC=C2)CC(C)O1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine?
The InChIKey is BWVCNPDMWYJTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-10-8-13(9-11(2)14-10)12-6-4-3-5-7-12/h4,6-7,10-11H,3,5,8-9H2,1-2H3.
What are the key properties of 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine?
4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine has a molecular weight of 193.29 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine is sourced from PubChem (CID 118406999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).