C12H19NO — CID 118407189
(2S,6R)-4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine (PubChem CID 118407189) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2S,6R)-4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 118407189 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2S,6R)-4-cyclohexa-1,5-dien-1-yl-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(C2=CCCC=C2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H19NO/c1-10-8-13(9-11(2)14-10)12-6-4-3-5-7-12/h4,6-7,10-11H,3,5,8-9H2,1-2H3/t10-,11+ |
| InChIKey | BWVCNPDMWYJTFT-PHIMTYICSA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |