C18H19ClIN3O2 — CID 118407429
4-chloro-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-iodopyridine-2-carboxamide (PubChem CID 118407429) has the molecular formula C18H19ClIN3O2 and a molecular weight of 471.73 g/mol. Its IUPAC name is 4-chloro-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-iodopyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-iodopyridine-2-carboxamide |
|---|---|
| PubChem CID | 118407429 |
| Molecular Formula | C18H19ClIN3O2 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 4-chloro-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-iodopyridine-2-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)c3nccc(Cl)c3I)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H19ClIN3O2/c1-11-9-23(10-12(2)25-11)14-5-3-13(4-6-14)22-18(24)17-16(20)15(19)7-8-21-17/h3-8,11-12H,9-10H2,1-2H3,(H,22,24)/t11-,12+ |
| InChIKey | DRBUHYPPTNCXRU-TXEJJXNPSA-N |
| XLogP | 4.21 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|