C16H19N3O6S — CID 118408669
[(3R,5S,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 118408669) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is [(3R,5S,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118408669 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(3R,5S,6S)-5-acetyloxy-4-azido-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Sc2ccccc2)[C@@H](OC(C)=O)C(N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C16H19N3O6S/c1-9(20)23-8-12-14(22)13(18-19-17)15(24-10(2)21)16(25-12)26-11-6-4-3-5-7-11/h3-7,12-16,22H,8H2,1-2H3/t12?,13?,14-,15-,16-/m0/s1 |
| InChIKey | AHEHCYUVVJXLOT-XJCPWDRGSA-N |
| XLogP | 2.04 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|