About 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole
2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole (PubChem CID 11840874) has the molecular formula C30H21ClN4
and a molecular weight of 472.98 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole |
| PubChem CID | 11840874 |
| Molecular Formula | C30H21ClN4 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole |
| SMILES | Clc1ccc(-c2nn(-c3ccccc3)cc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C30H21ClN4/c31-24-18-16-23(17-19-24)27-26(20-35(34-27)25-14-8-3-9-15-25)30-32-28(21-10-4-1-5-11-21)29(33-30)22-12-6-2-7-13-22/h1-20H,(H,32,33) |
| InChIKey | QREKPPLJTMSGTI-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole (CID 11840874) is 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole is Clc1ccc(-c2nn(-c3ccccc3)cc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1.
What is the InChIKey of 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole?
The InChIKey is QREKPPLJTMSGTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21ClN4/c31-24-18-16-23(17-19-24)27-26(20-35(34-27)25-14-8-3-9-15-25)30-32-28(21-10-4-1-5-11-21)29(33-30)22-12-6-2-7-13-22/h1-20H,(H,32,33).
What are the key properties of 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole?
2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole has a molecular weight of 472.98 g/mol, XLogP of 7.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 11840874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).