C6H8F4N2 — CID 118408959
(Z)-1,1,5,5-tetrafluoro-4-methyliminopent-2-en-2-amine (PubChem CID 118408959) has the molecular formula C6H8F4N2 and a molecular weight of 184.14 g/mol. Its IUPAC name is (Z)-1,1,5,5-tetrafluoro-4-methyliminopent-2-en-2-amine.
| Compound Name | (Z)-1,1,5,5-tetrafluoro-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 118408959 |
| Molecular Formula | C6H8F4N2 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (Z)-1,1,5,5-tetrafluoro-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(/C=C(\N)C(F)F)C(F)F |
| InChI | InChI=1S/C6H8F4N2/c1-12-4(6(9)10)2-3(11)5(7)8/h2,5-6H,11H2,1H3/b3-2-,12-4- |
| InChIKey | RIJGNRPWMCBCMZ-HLKZZCHESA-N |
| XLogP | 1.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|