About 7-methyl-1H-azonine-4,5-diol
7-methyl-1H-azonine-4,5-diol (PubChem CID 118409024) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 7-methyl-1H-azonine-4,5-diol.
Molecular Properties
| Compound Name | 7-methyl-1H-azonine-4,5-diol |
| PubChem CID | 118409024 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 7-methyl-1H-azonine-4,5-diol |
| SMILES | Cc1cc[nH]ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO2/c1-7-2-4-10-5-3-8(11)9(12)6-7/h2-6,10-12H,1H3/b4-2-,5-3-,7-6-,9-8- |
| InChIKey | XJDCZTSXLZWUAA-OCAUNROQSA-N |
| XLogP | 1.86 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-1H-azonine-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1H-azonine-4,5-diol?
The IUPAC name of 7-methyl-1H-azonine-4,5-diol (CID 118409024) is 7-methyl-1H-azonine-4,5-diol.
What is the SMILES notation for 7-methyl-1H-azonine-4,5-diol?
The canonical SMILES for 7-methyl-1H-azonine-4,5-diol is Cc1cc[nH]ccc(O)c(O)c1.
What is the InChIKey of 7-methyl-1H-azonine-4,5-diol?
The InChIKey is XJDCZTSXLZWUAA-OCAUNROQSA-N. The full InChI is InChI=1S/C9H11NO2/c1-7-2-4-10-5-3-8(11)9(12)6-7/h2-6,10-12H,1H3/b4-2-,5-3-,7-6-,9-8-.
What are the key properties of 7-methyl-1H-azonine-4,5-diol?
7-methyl-1H-azonine-4,5-diol has a molecular weight of 165.19 g/mol, XLogP of 1.86, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1H-azonine-4,5-diol is sourced from PubChem (CID 118409024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).