C19H24F3N3O3 — CID 118409072
1-[1-(oxane-4-carbonyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 118409072) has the molecular formula C19H24F3N3O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[1-(oxane-4-carbonyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-(oxane-4-carbonyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 118409072 |
| Molecular Formula | C19H24F3N3O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-[1-(oxane-4-carbonyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)NC1CCN(C(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C19H24F3N3O3/c20-19(21,22)14-1-3-15(4-2-14)23-18(27)24-16-5-9-25(10-6-16)17(26)13-7-11-28-12-8-13/h1-4,13,16H,5-12H2,(H2,23,24,27) |
| InChIKey | VROXFQMYCROQED-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |