C13H16N4O2 — CID 118409876
(2S,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolane-2-carbaldehyde (PubChem CID 118409876) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (2S,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolane-2-carbaldehyde.
| Compound Name | (2S,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 118409876 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2S,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-methyloxolane-2-carbaldehyde |
| SMILES | Cc1cn([C@H]2C[C@H](C)[C@@H](C=O)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C13H16N4O2/c1-7-3-10(19-9(7)5-18)17-4-8(2)11-12(14)15-6-16-13(11)17/h4-7,9-10H,3H2,1-2H3,(H2,14,15,16)/t7-,9+,10+/m0/s1 |
| InChIKey | UYJYQEUPZGGJJH-FXBDTBDDSA-N |
| XLogP | 1.44 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|