About N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline
N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline (PubChem CID 11840989) has the molecular formula C9H7FN6
and a molecular weight of 218.20 g/mol. Its IUPAC name is N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline.
Molecular Properties
| Compound Name | N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline |
| PubChem CID | 11840989 |
| Molecular Formula | C9H7FN6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline |
| SMILES | [H]/N=c1\nn/c(=N\[H])c1=NNc1ccc(F)cc1 |
| InChI | InChI=1S/C9H7FN6/c10-5-1-3-6(4-2-5)13-14-7-8(11)15-16-9(7)12/h1-4,11-13H/b11-8-,12-9- |
| InChIKey | XCDRRKZJZOYQRS-QAHSQZNUSA-N |
| XLogP | -0.62 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline?
The IUPAC name of N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline (CID 11840989) is N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline.
What is the SMILES notation for N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline?
The canonical SMILES for N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline is [H]/N=c1\nn/c(=N\[H])c1=NNc1ccc(F)cc1.
What is the InChIKey of N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline?
The InChIKey is XCDRRKZJZOYQRS-QAHSQZNUSA-N. The full InChI is InChI=1S/C9H7FN6/c10-5-1-3-6(4-2-5)13-14-7-8(11)15-16-9(7)12/h1-4,11-13H/b11-8-,12-9-.
What are the key properties of N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline?
N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline has a molecular weight of 218.20 g/mol, XLogP of -0.62, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-diiminopyrazol-4-ylidene)amino]-4-fluoroaniline is sourced from PubChem (CID 11840989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).