About 1H-indol-3-yl acetate
1H-indol-3-yl acetate (PubChem CID 11841) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1H-indol-3-yl acetate.
Molecular Properties
| Compound Name | 1H-indol-3-yl acetate |
| PubChem CID | 11841 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1H-indol-3-yl acetate |
| SMILES | CC(=O)Oc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| InChIKey | JBOPQACSHPPKEP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indol-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-yl acetate?
The IUPAC name of 1H-indol-3-yl acetate (CID 11841) is 1H-indol-3-yl acetate.
What is the SMILES notation for 1H-indol-3-yl acetate?
The canonical SMILES for 1H-indol-3-yl acetate is CC(=O)Oc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indol-3-yl acetate?
The InChIKey is JBOPQACSHPPKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3.
What are the key properties of 1H-indol-3-yl acetate?
1H-indol-3-yl acetate has a molecular weight of 175.19 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-yl acetate is sourced from PubChem (CID 11841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).