C27H36N2O2 — CID 118410035
1-[3-(dimethylamino)propyl]-3-(1,3-diphenylpentyl)-4-methylpyrrolidine-2,5-dione (PubChem CID 118410035) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(1,3-diphenylpentyl)-4-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(1,3-diphenylpentyl)-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118410035 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(1,3-diphenylpentyl)-4-methylpyrrolidine-2,5-dione |
| SMILES | CCC(CC(c1ccccc1)C1C(=O)N(CCCN(C)C)C(=O)C1C)c1ccccc1 |
| InChI | InChI=1S/C27H36N2O2/c1-5-21(22-13-8-6-9-14-22)19-24(23-15-10-7-11-16-23)25-20(2)26(30)29(27(25)31)18-12-17-28(3)4/h6-11,13-16,20-21,24-25H,5,12,17-19H2,1-4H3 |
| InChIKey | ATNNMACAXPMDIJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|