About 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine
4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine (PubChem CID 11841028) has the molecular formula C15H15ClN4
and a molecular weight of 286.77 g/mol. Its IUPAC name is 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine.
Molecular Properties
| Compound Name | 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine |
| PubChem CID | 11841028 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine |
| SMILES | Cc1ccc2c(Cl)c(C)c(-n3nc(C)cc3C)nc2n1 |
| InChI | InChI=1S/C15H15ClN4/c1-8-5-6-12-13(16)11(4)15(18-14(12)17-8)20-10(3)7-9(2)19-20/h5-7H,1-4H3 |
| InChIKey | XOFGSUYJMWCMHG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine?
The IUPAC name of 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine (CID 11841028) is 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine.
What is the SMILES notation for 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine?
The canonical SMILES for 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine is Cc1ccc2c(Cl)c(C)c(-n3nc(C)cc3C)nc2n1.
What is the InChIKey of 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine?
The InChIKey is XOFGSUYJMWCMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN4/c1-8-5-6-12-13(16)11(4)15(18-14(12)17-8)20-10(3)7-9(2)19-20/h5-7H,1-4H3.
What are the key properties of 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine?
4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine has a molecular weight of 286.77 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1,8-naphthyridine is sourced from PubChem (CID 11841028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).