About 2-hexyl-4,6-dimethyl-1,3,5-triazine
2-hexyl-4,6-dimethyl-1,3,5-triazine (PubChem CID 118410366) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-hexyl-4,6-dimethyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-hexyl-4,6-dimethyl-1,3,5-triazine |
| PubChem CID | 118410366 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-hexyl-4,6-dimethyl-1,3,5-triazine |
| SMILES | CCCCCCc1nc(C)nc(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-4-5-6-7-8-11-13-9(2)12-10(3)14-11/h4-8H2,1-3H3 |
| InChIKey | WULMYDHPNNFSFG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-4,6-dimethyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-4,6-dimethyl-1,3,5-triazine?
The IUPAC name of 2-hexyl-4,6-dimethyl-1,3,5-triazine (CID 118410366) is 2-hexyl-4,6-dimethyl-1,3,5-triazine.
What is the SMILES notation for 2-hexyl-4,6-dimethyl-1,3,5-triazine?
The canonical SMILES for 2-hexyl-4,6-dimethyl-1,3,5-triazine is CCCCCCc1nc(C)nc(C)n1.
What is the InChIKey of 2-hexyl-4,6-dimethyl-1,3,5-triazine?
The InChIKey is WULMYDHPNNFSFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-4-5-6-7-8-11-13-9(2)12-10(3)14-11/h4-8H2,1-3H3.
What are the key properties of 2-hexyl-4,6-dimethyl-1,3,5-triazine?
2-hexyl-4,6-dimethyl-1,3,5-triazine has a molecular weight of 193.29 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-4,6-dimethyl-1,3,5-triazine is sourced from PubChem (CID 118410366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).