C23H31FN2O5 — CID 118411081
(2R,3R,4R,5S)-1-[5-[[4-(2-fluoro-4-pyridinyl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 118411081) has the molecular formula C23H31FN2O5 and a molecular weight of 434.51 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[5-[[4-(2-fluoro-4-pyridinyl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[5-[[4-(2-fluoro-4-pyridinyl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118411081 |
| Molecular Formula | C23H31FN2O5 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (2R,3R,4R,5S)-1-[5-[[4-(2-fluoro-4-pyridinyl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCOCc1ccc(-c2ccnc(F)c2)cc1 |
| InChI | InChI=1S/C23H31FN2O5/c24-21-12-18(8-9-25-21)17-6-4-16(5-7-17)15-31-11-3-1-2-10-26-13-20(28)23(30)22(29)19(26)14-27/h4-9,12,19-20,22-23,27-30H,1-3,10-11,13-15H2/t19-,20+,22-,23-/m1/s1 |
| InChIKey | JTKFISWXXXQDSQ-IRMYBRCSSA-N |
| XLogP | 1.33 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|