C25H35NO6 — CID 118411135
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[[4-(2-methoxyphenyl)phenyl]methoxy]pentyl]piperidine-3,4,5-triol (PubChem CID 118411135) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[[4-(2-methoxyphenyl)phenyl]methoxy]pentyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[[4-(2-methoxyphenyl)phenyl]methoxy]pentyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118411135 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[[4-(2-methoxyphenyl)phenyl]methoxy]pentyl]piperidine-3,4,5-triol |
| SMILES | COc1ccccc1-c1ccc(COCCCCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)cc1 |
| InChI | InChI=1S/C25H35NO6/c1-31-23-8-4-3-7-20(23)19-11-9-18(10-12-19)17-32-14-6-2-5-13-26-15-22(28)25(30)24(29)21(26)16-27/h3-4,7-12,21-22,24-25,27-30H,2,5-6,13-17H2,1H3/t21-,22+,24-,25-/m1/s1 |
| InChIKey | XEZREDYRCTYQGC-PEISPCAHSA-N |
| XLogP | 1.81 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|