C32H29N7S2 — CID 118411186
[1-[(4-phenylphenyl)methyl]-2,3-dihydroindol-5-yl]-[4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazene (PubChem CID 118411186) has the molecular formula C32H29N7S2 and a molecular weight of 575.77 g/mol. Its IUPAC name is [1-[(4-phenylphenyl)methyl]-2,3-dihydroindol-5-yl]-[4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazene.
| Compound Name | [1-[(4-phenylphenyl)methyl]-2,3-dihydroindol-5-yl]-[4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazene |
|---|---|
| PubChem CID | 118411186 |
| Molecular Formula | C32H29N7S2 |
| Molecular Weight | 575.77 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | [1-[(4-phenylphenyl)methyl]-2,3-dihydroindol-5-yl]-[4-[(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]diazene |
| SMILES | CCCSc1nnc(/N=N/c2ccc(/N=N/c3ccc4c(c3)CCN4Cc3ccc(-c4ccccc4)cc3)cc2)s1 |
| InChI | InChI=1S/C32H29N7S2/c1-2-20-40-32-38-37-31(41-32)36-34-28-14-12-27(13-15-28)33-35-29-16-17-30-26(21-29)18-19-39(30)22-23-8-10-25(11-9-23)24-6-4-3-5-7-24/h3-17,21H,2,18-20,22H2,1H3/b35-33+,36-34+ |
| InChIKey | YJMMQLIYSFPGKF-LBYUQGKWSA-N |
| XLogP | 10.10 |
| TPSA | 78.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.77 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|