About N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide
N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide (PubChem CID 118411247) has the molecular formula C18H14N2OS
and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide.
Molecular Properties
| Compound Name | N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide |
| PubChem CID | 118411247 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide |
| SMILES | C=Cn1c(-c2ccccc2)cs/c1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14N2OS/c1-2-20-16(14-9-5-3-6-10-14)13-22-18(20)19-17(21)15-11-7-4-8-12-15/h2-13H,1H2/b19-18- |
| InChIKey | RNDFCQZQHMXGRL-HNENSFHCSA-N |
| XLogP | 4.06 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide?
The IUPAC name of N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide (CID 118411247) is N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide.
What is the SMILES notation for N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide?
The canonical SMILES for N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide is C=Cn1c(-c2ccccc2)cs/c1=N\C(=O)c1ccccc1.
What is the InChIKey of N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide?
The InChIKey is RNDFCQZQHMXGRL-HNENSFHCSA-N. The full InChI is InChI=1S/C18H14N2OS/c1-2-20-16(14-9-5-3-6-10-14)13-22-18(20)19-17(21)15-11-7-4-8-12-15/h2-13H,1H2/b19-18-.
What are the key properties of N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide?
N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide has a molecular weight of 306.39 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethenyl-4-phenyl-1,3-thiazol-2-ylidene)benzamide is sourced from PubChem (CID 118411247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).