About methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate
methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate (PubChem CID 118411250) has the molecular formula C11H14F3N3O3S
and a molecular weight of 325.31 g/mol. Its IUPAC name is methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate |
| PubChem CID | 118411250 |
| Molecular Formula | C11H14F3N3O3S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)C1(NC1NCCS1)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O3S/c1-5-6(7(18)20-2)10(8(19)16-5,11(12,13)14)17-9-15-3-4-21-9/h9,15,17H,3-4H2,1-2H3,(H,16,19) |
| InChIKey | IYCAYAZSJFHHTB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate?
The IUPAC name of methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate (CID 118411250) is methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate.
What is the SMILES notation for methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate?
The canonical SMILES for methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate is COC(=O)C1=C(C)NC(=O)C1(NC1NCCS1)C(F)(F)F.
What is the InChIKey of methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate?
The InChIKey is IYCAYAZSJFHHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3O3S/c1-5-6(7(18)20-2)10(8(19)16-5,11(12,13)14)17-9-15-3-4-21-9/h9,15,17H,3-4H2,1-2H3,(H,16,19).
What are the key properties of methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate?
methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate has a molecular weight of 325.31 g/mol, XLogP of 0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-5-oxo-4-(1,3-thiazolidin-2-ylamino)-4-(trifluoromethyl)-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 118411250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).