About (E)-1,3-diaminobut-1-en-1-ol
(E)-1,3-diaminobut-1-en-1-ol (PubChem CID 118411260) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is (E)-1,3-diaminobut-1-en-1-ol.
Molecular Properties
| Compound Name | (E)-1,3-diaminobut-1-en-1-ol |
| PubChem CID | 118411260 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | (E)-1,3-diaminobut-1-en-1-ol |
| SMILES | CC(N)/C=C(\N)O |
| InChI | InChI=1S/C4H10N2O/c1-3(5)2-4(6)7/h2-3,7H,5-6H2,1H3/b4-2+ |
| InChIKey | GUPFKYFLTHTNLG-DUXPYHPUSA-N |
| XLogP | -0.31 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,3-diaminobut-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,3-diaminobut-1-en-1-ol?
The IUPAC name of (E)-1,3-diaminobut-1-en-1-ol (CID 118411260) is (E)-1,3-diaminobut-1-en-1-ol.
What is the SMILES notation for (E)-1,3-diaminobut-1-en-1-ol?
The canonical SMILES for (E)-1,3-diaminobut-1-en-1-ol is CC(N)/C=C(\N)O.
What is the InChIKey of (E)-1,3-diaminobut-1-en-1-ol?
The InChIKey is GUPFKYFLTHTNLG-DUXPYHPUSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3(5)2-4(6)7/h2-3,7H,5-6H2,1H3/b4-2+.
What are the key properties of (E)-1,3-diaminobut-1-en-1-ol?
(E)-1,3-diaminobut-1-en-1-ol has a molecular weight of 102.14 g/mol, XLogP of -0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,3-diaminobut-1-en-1-ol is sourced from PubChem (CID 118411260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).