About (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole
(3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole (PubChem CID 118411289) has the molecular formula C15H17N3
and a molecular weight of 239.32 g/mol. Its IUPAC name is (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole |
| PubChem CID | 118411289 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole |
| SMILES | C[C@H]1CNc2ccc(CCc3cncnc3)cc21 |
| InChI | InChI=1S/C15H17N3/c1-11-7-18-15-5-4-12(6-14(11)15)2-3-13-8-16-10-17-9-13/h4-6,8-11,18H,2-3,7H2,1H3/t11-/m0/s1 |
| InChIKey | SKAKOZRECCXARS-NSHDSACASA-N |
| XLogP | 2.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole?
The IUPAC name of (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole (CID 118411289) is (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole?
The canonical SMILES for (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole is C[C@H]1CNc2ccc(CCc3cncnc3)cc21.
What is the InChIKey of (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole?
The InChIKey is SKAKOZRECCXARS-NSHDSACASA-N. The full InChI is InChI=1S/C15H17N3/c1-11-7-18-15-5-4-12(6-14(11)15)2-3-13-8-16-10-17-9-13/h4-6,8-11,18H,2-3,7H2,1H3/t11-/m0/s1.
What are the key properties of (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole?
(3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole has a molecular weight of 239.32 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyl-5-(2-pyrimidin-5-ylethyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 118411289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).