C19H15F6N5O2 — CID 118411827
1-methyl-4-[3-methyl-2-[[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxymethyl]phenyl]tetrazol-5-one (PubChem CID 118411827) has the molecular formula C19H15F6N5O2 and a molecular weight of 459.35 g/mol. Its IUPAC name is 1-methyl-4-[3-methyl-2-[[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxymethyl]phenyl]tetrazol-5-one.
| Compound Name | 1-methyl-4-[3-methyl-2-[[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxymethyl]phenyl]tetrazol-5-one |
|---|---|
| PubChem CID | 118411827 |
| Molecular Formula | C19H15F6N5O2 |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 1-methyl-4-[3-methyl-2-[[(E)-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxymethyl]phenyl]tetrazol-5-one |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1CO/N=C(\c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C19H15F6N5O2/c1-11-5-3-8-15(30-17(31)29(2)27-28-30)14(11)10-32-26-16(19(23,24)25)12-6-4-7-13(9-12)18(20,21)22/h3-9H,10H2,1-2H3/b26-16+ |
| InChIKey | CNCYZFNYJQGKBQ-WGOQTCKBSA-N |
| XLogP | 3.78 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|